CAS 1004644-51-2 is the registry number for 2-(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)acetohydrazide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetohydrazide (CAS 1004644-51-2) is a chemical compound with the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. IUPAC name: 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetohydrazide. InChIKey: DIJCBEIYSXKZOB-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN4O |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetohydrazide |
| InChIKey | DIJCBEIYSXKZOB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(=O)NN)C)Cl |
Computed by PubChem (NCBI)