CAS 1004968-11-9 is the registry number for [(1-Chloro-2-methylcyclopropyl)sulfinyl]benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(1-chloro-2-methylcyclopropyl)sulfinylbenzene (CAS 1004968-11-9) is a chemical compound with the molecular formula C10H11ClOS and a molecular weight of 214.71 g/mol. IUPAC name: (1-chloro-2-methylcyclopropyl)sulfinylbenzene. InChIKey: BASQNYBLNPBUEJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClOS |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | (1-chloro-2-methylcyclopropyl)sulfinylbenzene |
| InChIKey | BASQNYBLNPBUEJ-UHFFFAOYSA-N |
| SMILES | CC1CC1(S(=O)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)