CAS 181997-71-7 appears in our catalog under these names: 1-(2-Chloro-3-methyl-4-methylsulfanyl-phenyl)-ethanone, 95%, 1–(2–Chloro–3–methyl–4–(methylthio)phenyl)ethanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(2-chloro-3-methyl-4-methylsulfanylphenyl)ethanone (CAS 181997-71-7) is a chemical compound with the molecular formula C10H11ClOS and a molecular weight of 214.71 g/mol. IUPAC name: 1-(2-chloro-3-methyl-4-methylsulfanylphenyl)ethanone. InChIKey: ZSHNSXSONOHWNB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClOS |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | 1-(2-chloro-3-methyl-4-methylsulfanylphenyl)ethanone |
| InChIKey | ZSHNSXSONOHWNB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)C(=O)C)SC |
Computed by PubChem (NCBI)