CAS 869945-06-2 is the registry number for 5-Methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride (CAS 869945-06-2) is a chemical compound with the molecular formula C10H11ClOS and a molecular weight of 214.71 g/mol. IUPAC name: 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride. InChIKey: RAQMTDUDQJTUHH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClOS |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride |
| InChIKey | RAQMTDUDQJTUHH-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C=C(S2)C(=O)Cl |
Computed by PubChem (NCBI)