Products 1042793-22-5
CAS 1042793-22-5 appears in our catalog under these names: 5,6,7,8-Tetrahydro-4h-cyclohepta[b]thiophene-2-carbonyl chloride, 95%, 5,6,7,8-Tetrahydro-4h-cyclohepta(b)thiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl chloride (CAS 1042793-22-5) is a chemical compound with the molecular formula C10H11ClOS and a molecular weight of 214.71 g/mol. IUPAC name: 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl chloride. InChIKey: YPRCPTYRZQKXEV-UHFFFAOYSA-N.
| Molecular formula | C10H11ClOS |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl chloride |
| InChIKey | YPRCPTYRZQKXEV-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)SC(=C2)C(=O)Cl |
Computed by PubChem (NCBI)