CAS 1341438-16-1 appears in our catalog under these names: 2-Chloro-6-(propan-2-ylsulfanyl)benzaldehyde, 95%, 2-Chloro-6-(propan-2-ylsulfanyl)benzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-6-propan-2-ylsulfanylbenzaldehyde (CAS 1341438-16-1) is a chemical compound with the molecular formula C10H11ClOS and a molecular weight of 214.71 g/mol. IUPAC name: 2-chloro-6-propan-2-ylsulfanylbenzaldehyde. InChIKey: WTPBDWDYLAVYEB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClOS |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | 2-chloro-6-propan-2-ylsulfanylbenzaldehyde |
| InChIKey | WTPBDWDYLAVYEB-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=C(C(=CC=C1)Cl)C=O |
Computed by PubChem (NCBI)