CAS 1005057-07-7 appears in our catalog under these names: 4-(5,6-Dichloro-1,3-dioxooctahydro-2h-4,7-methanoisoindol-2-yl)benzoic acid, 95%, 4-(5,6-Dichloro-1,3-dioxohexahydro-1H-4,7-methanoisoindol-2(3H)-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(8,9-dichloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoic acid (CAS 1005057-07-7) is a chemical compound with the molecular formula C16H13Cl2NO4 and a molecular weight of 354.2 g/mol. IUPAC name: 4-(8,9-dichloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoic acid. InChIKey: OOBGVVFRNDCBEK-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO4 |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | 4-(8,9-dichloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoic acid |
| InChIKey | OOBGVVFRNDCBEK-UHFFFAOYSA-N |
| SMILES | C1C2C3C(C1C(C2Cl)Cl)C(=O)N(C3=O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)