CAS 438030-83-2 is the registry number for N-(2,6-Dichlorophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(2,6-dichlorophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide (CAS 438030-83-2) is a chemical compound with the molecular formula C16H13Cl2NO4 and a molecular weight of 354.2 g/mol. IUPAC name: N-(2,6-dichlorophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide. InChIKey: YLMOHQOJZSROIK-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO4 |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide |
| InChIKey | YLMOHQOJZSROIK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC(=O)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)