Products 2748492-20-6
CAS 2748492-20-6 appears in our catalog under these names: Aceclofenac-d4 (phenyl-d4-acetoxy), 97 atom % D, min 98% Chemical Purity, Aceclofenac-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg.
2-[2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid (CAS 2748492-20-6) is a chemical compound with the molecular formula C16H13Cl2NO4 and a molecular weight of 358.2 g/mol. IUPAC name: 2-[2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid. InChIKey: MNIPYSSQXLZQLJ-SCFZSLNVSA-N.
| Molecular formula | C16H13Cl2NO4 |
|---|---|
| Molecular weight | 358.2 g/mol |
| IUPAC name | 2-[2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid |
| InChIKey | MNIPYSSQXLZQLJ-SCFZSLNVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])CC(=O)OCC(=O)O)NC2=C(C=CC=C2Cl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Aceclofenac-d4, Aceclofenac-d4 (phenyl-d4-acetoxy)