Products 1012207-68-9
CAS 1012207-68-9 appears in our catalog under these names: 2-(4-(2-(2,4-Dichlorophenoxy)acetamido)phenyl)acetic acid, 98%, 98%, 2-(4-(2-(2,4-Dichlorophenoxy)acetamido)phenyl)acetic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
2-[4-[[2-(2,4-dichlorophenoxy)acetyl]amino]phenyl]acetic acid (CAS 1012207-68-9) is a chemical compound with the molecular formula C16H13Cl2NO4 and a molecular weight of 354.2 g/mol. IUPAC name: 2-[4-[[2-(2,4-dichlorophenoxy)acetyl]amino]phenyl]acetic acid. InChIKey: OVJOXMSYQWMNEO-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO4 |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | 2-[4-[[2-(2,4-dichlorophenoxy)acetyl]amino]phenyl]acetic acid |
| InChIKey | OVJOXMSYQWMNEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)NC(=O)COC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)