CAS 1795019-63-4 appears in our catalog under these names: Aceclofenac-d4,13C2 (major), Aceclofenac-d4,13C2. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
2-[2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid (CAS 1795019-63-4) is a chemical compound with the molecular formula C16H13Cl2NO4 and a molecular weight of 360.2 g/mol. IUPAC name: 2-[2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid. InChIKey: MNIPYSSQXLZQLJ-UVMBEDSSSA-N.
| Molecular formula | C16H13Cl2NO4 |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 2-[2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid |
| InChIKey | MNIPYSSQXLZQLJ-UVMBEDSSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])CC(=O)O[13CH2][13C](=O)O)NC2=C(C=CC=C2Cl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)