CAS 100510-64-3 appears in our catalog under these names: 3,3–Dimethyl–6–nitroindolin–2–one, 3,3-Dimethyl-6-nitroindolin-2-one 95%, 3,3-Dimethyl-6-nitroindolin-2-one, 98%, 98%, 3,3-Dimethyl-6-nitroindolin-2-one, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3,3-dimethyl-6-nitro-1H-indol-2-one (CAS 100510-64-3) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 3,3-dimethyl-6-nitro-1H-indol-2-one. InChIKey: JTVMMOAEEVKAGQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 3,3-dimethyl-6-nitro-1H-indol-2-one |
| InChIKey | JTVMMOAEEVKAGQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)[N+](=O)[O-])NC1=O)C |
Computed by PubChem (NCBI)