Products 100510-65-4
CAS 100510-65-4 appears in our catalog under these names: 6-Amino-3,3-dimethylindolin-2-one, 96%, 6-Amino-3,3-dimethylindolin-2-one 98%, 6-Amino-3,3-dimethylindolin-2-one 95%, 6-Amino-3,3-dimethylindolin-2-one, 95%, 95%, 6-Amino-3,3-dimethyl-2-oxo-1,3-dihydro-indole, ≥97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
6-amino-3,3-dimethyl-1H-indol-2-one (CAS 100510-65-4) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 6-amino-3,3-dimethyl-1H-indol-2-one. InChIKey: IWARVYFPBLDOAK-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-amino-3,3-dimethyl-1H-indol-2-one |
| InChIKey | IWARVYFPBLDOAK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)N)NC1=O)C |
Computed by PubChem (NCBI)