CAS 1005196-61-1 appears in our catalog under these names: methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate, 95%, 95%, METHYL 4-CHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE-6-CARBOXYLATE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (CAS 1005196-61-1) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate. InChIKey: AFQBPDNQDJCMTA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| InChIKey | AFQBPDNQDJCMTA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=C1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)