CAS 1005336-42-4 appears in our catalog under these names: 4-(Chloromethyl)-2-(3,4-difluorophenyl)-1,3-oxazole, 4-(Chloromethyl)-2-(3,4-difluorophenyl)-1,3-oxazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
4-(chloromethyl)-2-(3,4-difluorophenyl)-1,3-oxazole (CAS 1005336-42-4) is a chemical compound with the molecular formula C10H6ClF2NO and a molecular weight of 229.61 g/mol. IUPAC name: 4-(chloromethyl)-2-(3,4-difluorophenyl)-1,3-oxazole. InChIKey: RHRWTBORHGIPTG-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF2NO |
|---|---|
| Molecular weight | 229.61 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(3,4-difluorophenyl)-1,3-oxazole |
| InChIKey | RHRWTBORHGIPTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC(=CO2)CCl)F)F |
Computed by PubChem (NCBI)