Products 2260930-81-0
CAS 2260930-81-0 is the registry number for 2-Chloro-7-(difluoromethoxy)quinoline, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-chloro-7-(difluoromethoxy)quinoline (CAS 2260930-81-0) is a chemical compound with the molecular formula C10H6ClF2NO and a molecular weight of 229.61 g/mol. IUPAC name: 2-chloro-7-(difluoromethoxy)quinoline. InChIKey: KIJJNHOORIZBAR-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF2NO |
|---|---|
| Molecular weight | 229.61 g/mol |
| IUPAC name | 2-chloro-7-(difluoromethoxy)quinoline |
| InChIKey | KIJJNHOORIZBAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Cl)OC(F)F |
Computed by PubChem (NCBI)