CAS 1158127-34-4 appears in our catalog under these names: 3-Chloro-3-(3-(difluoromethoxy)phenyl)prop-2-enenitrile, 95%, 3-Chloro-3-(3-(difluoromethoxy)phenyl)prop-2-enenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(Z)-3-chloro-3-[3-(difluoromethoxy)phenyl]prop-2-enenitrile (CAS 1158127-34-4) is a chemical compound with the molecular formula C10H6ClF2NO and a molecular weight of 229.61 g/mol. IUPAC name: (Z)-3-chloro-3-[3-(difluoromethoxy)phenyl]prop-2-enenitrile. InChIKey: IRDROZQKDACOBB-WTKPLQERSA-N.
| Molecular formula | C10H6ClF2NO |
|---|---|
| Molecular weight | 229.61 g/mol |
| IUPAC name | (Z)-3-chloro-3-[3-(difluoromethoxy)phenyl]prop-2-enenitrile |
| InChIKey | IRDROZQKDACOBB-WTKPLQERSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)/C(=C/C#N)/Cl |
Computed by PubChem (NCBI)