CAS 1183584-82-8 appears in our catalog under these names: 4-(Chloromethyl)-2-(2,6-difluorophenyl)-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(2,6-difluorophenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(chloromethyl)-2-(2,6-difluorophenyl)-1,3-oxazole (CAS 1183584-82-8) is a chemical compound with the molecular formula C10H6ClF2NO and a molecular weight of 229.61 g/mol. IUPAC name: 4-(chloromethyl)-2-(2,6-difluorophenyl)-1,3-oxazole. InChIKey: BWPZPSZETNAYRN-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF2NO |
|---|---|
| Molecular weight | 229.61 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(2,6-difluorophenyl)-1,3-oxazole |
| InChIKey | BWPZPSZETNAYRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NC(=CO2)CCl)F |
Computed by PubChem (NCBI)