CAS 1339490-19-5 appears in our catalog under these names: 6-Chloro-2-(difluoromethyl)quinolin-4(1H)-one, 98%, 6-Chloro-2-(difluoromethyl)-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g, 50mg.
6-chloro-2-(difluoromethyl)-1H-quinolin-4-one (CAS 1339490-19-5) is a chemical compound with the molecular formula C10H6ClF2NO and a molecular weight of 229.61 g/mol. IUPAC name: 6-chloro-2-(difluoromethyl)-1H-quinolin-4-one. InChIKey: PRUGMEQMQJSQSK-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF2NO |
|---|---|
| Molecular weight | 229.61 g/mol |
| IUPAC name | 6-chloro-2-(difluoromethyl)-1H-quinolin-4-one |
| InChIKey | PRUGMEQMQJSQSK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C=C(N2)C(F)F |
Computed by PubChem (NCBI)