Products 1005341-52-5
CAS 1005341-52-5 appears in our catalog under these names: (1R)–1–(Adamantan–1–yl)ethan–1–amine hydrochloride, (1R)-1-(Adamantan-1-yl)ethan-1-amine hydrochloride, (1R)-1-(adamantan-1-yl)ethan-1-amine hydrochloride, 97%, 97%. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 2,5g, 500mg, 1g.
(1R)-1-(1-adamantyl)ethanamine;hydrochloride (CAS 1005341-52-5) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 215.76 g/mol. IUPAC name: (1R)-1-(1-adamantyl)ethanamine;hydrochloride. InChIKey: OZBDFBJXRJWNAV-VUPGYFAFSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 215.76 g/mol |
| IUPAC name | (1R)-1-(1-adamantyl)ethanamine;hydrochloride |
| InChIKey | OZBDFBJXRJWNAV-VUPGYFAFSA-N |
| SMILES | C[C@H](C12CC3CC(C1)CC(C3)C2)N.Cl |
Computed by PubChem (NCBI)