Products 350818-67-6
CAS 350818-67-6 appears in our catalog under these names: Rimantadine-d4 HCl (ethyl-d4), 98 atom % D, min 98% Chemical Purity, Rimantadine-d4 Hydrochloride, >95% (HPLC), Rimantadine–d4 hydrochloride, Rimantadine-d4 hydrochloride, Rimantadine-d4 (hydrochloride), 99.0%. Offered by: CDN, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 2,5mg, 5mg, 10mg, 50mg, 25mg.
1-(1-adamantyl)-1,2,2,2-tetradeuterioethanamine;hydrochloride (CAS 350818-67-6) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 219.79 g/mol. IUPAC name: 1-(1-adamantyl)-1,2,2,2-tetradeuterioethanamine;hydrochloride. InChIKey: OZBDFBJXRJWNAV-VQQQFJCBSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 219.79 g/mol |
| IUPAC name | 1-(1-adamantyl)-1,2,2,2-tetradeuterioethanamine;hydrochloride |
| InChIKey | OZBDFBJXRJWNAV-VQQQFJCBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C12CC3CC(C1)CC(C3)C2)N.Cl |
Computed by PubChem (NCBI)