CAS 100537-30-2 appears in our catalog under these names: 1-Phenoxyphthalazine, 95%, 1-Phenoxyphthalazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 500mg.
1-phenoxyphthalazine (CAS 100537-30-2) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 1-phenoxyphthalazine. InChIKey: CSHSXUZQMJVDJY-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-phenoxyphthalazine |
| InChIKey | CSHSXUZQMJVDJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NN=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)