CAS 1417640-17-5 appears in our catalog under these names: 1(2H)-Isoquinolinone, 7-(3-pyridinyl)-, 95%, 7–(3–Pyridyl) –1(2H)–isoquinoline, 1(2H)-ISoquinolinone, 7-(3-pyridinyl)-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
7-pyridin-3-yl-2H-isoquinolin-1-one (CAS 1417640-17-5) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 7-pyridin-3-yl-2H-isoquinolin-1-one. InChIKey: ICKRXIFCUKAOGN-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 7-pyridin-3-yl-2H-isoquinolin-1-one |
| InChIKey | ICKRXIFCUKAOGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC3=C(C=C2)C=CNC3=O |
Computed by PubChem (NCBI)