CAS 1005615-47-3 appears in our catalog under these names: Methyl 3-(4-bromo-1h-pyrazol-1-yl)-2-methylpropanoate, 95%, 3-(4-Bromo-pyrazol-1-yl)-2-methyl-propionic acid methyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 2,5g.
Methyl 3-(4-bromopyrazol-1-yl)-2-methylpropanoate (CAS 1005615-47-3) is a chemical compound with the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. IUPAC name: methyl 3-(4-bromopyrazol-1-yl)-2-methylpropanoate. InChIKey: DPUDEVDDEIUTCA-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | methyl 3-(4-bromopyrazol-1-yl)-2-methylpropanoate |
| InChIKey | DPUDEVDDEIUTCA-UHFFFAOYSA-N |
| SMILES | CC(CN1C=C(C=N1)Br)C(=O)OC |
Computed by PubChem (NCBI)