CAS 512809-48-2 is the registry number for 3-(4-Bromo-3,5-dimethyl-1h-pyrazol-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid (CAS 512809-48-2) is a chemical compound with the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. IUPAC name: 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid. InChIKey: QTOFWFGESPQEHM-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid |
| InChIKey | QTOFWFGESPQEHM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCC(=O)O)C)Br |
Computed by PubChem (NCBI)