Products 512809-48-2

CAS 512809-48-2 is the registry number for 3-(4-Bromo-3,5-dimethyl-1h-pyrazol-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid (CAS 512809-48-2) is a chemical compound with the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. IUPAC name: 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid. InChIKey: QTOFWFGESPQEHM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BrN2O2
Molecular weight247.09 g/mol
IUPAC name3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid
InChIKeyQTOFWFGESPQEHM-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CCC(=O)O)C)Br

Computed by PubChem (NCBI)