Products 69447-84-3
CAS 69447-84-3 appears in our catalog under these names: 4-Nitrophenylethylamine hydrobromide, 98%, 4–Nitrophenylethylamine Hydrobromide, 4-Nitrophenylethylamine Hydrobromide, ≥98%, ≥98%, 4-Nitrophenylethylamine hydrobromide, 98%+,RG. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
2-(4-nitrophenyl)ethanamine;hydrobromide (CAS 69447-84-3) is a chemical compound with the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. IUPAC name: 2-(4-nitrophenyl)ethanamine;hydrobromide. InChIKey: IXEDXMYYHOYVRD-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 2-(4-nitrophenyl)ethanamine;hydrobromide |
| InChIKey | IXEDXMYYHOYVRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)[N+](=O)[O-].Br |
Computed by PubChem (NCBI)
Synonyms:
2-(4-nitrophenyl)ethan-1-amine hydrobromide, 4-Nitrophenylethylamine hydrobromide, 4-Nitrophenylethylamine HBr, 2-(4-nitrophenyl)ethanamine;hydrobromide, 2-(4-nitrophenyl)ethanamine hydrobromide, Benzeneethanamine, 4-nitro-, monohydrobromide, 2-(4-Nnitrophenyl)ethylamine hydrobromide, 2-(4-Nitrophenyl)ethan-1-amine--hydrogen bromide (1/1)