Products 877977-08-7
CAS 877977-08-7 appears in our catalog under these names: 2-Bromo-n-(5-methylisoxazol-3-yl)butanamide, 95%, 2-Bromo-N-(5-methyl-1,2-oxazol-3-yl)butanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-bromo-N-(5-methyl-1,2-oxazol-3-yl)butanamide (CAS 877977-08-7) is a chemical compound with the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. IUPAC name: 2-bromo-N-(5-methyl-1,2-oxazol-3-yl)butanamide. InChIKey: XJVMTBXUJAQJKS-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 2-bromo-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
| InChIKey | XJVMTBXUJAQJKS-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)NC1=NOC(=C1)C)Br |
Computed by PubChem (NCBI)