CAS 60061-73-6 appears in our catalog under these names: 2-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)propanoic acid, 2-(4-Bromo-3,5-dimethyl-pyrazol-1-yl)-propionic acid. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g.
2-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid (CAS 60061-73-6) is a chemical compound with the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. IUPAC name: 2-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid. InChIKey: PQWOGJIMXLPNMR-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoic acid |
| InChIKey | PQWOGJIMXLPNMR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(C)C(=O)O)C)Br |
Computed by PubChem (NCBI)