Products 1005627-55-3
CAS 1005627-55-3 is the registry number for 1-Ethyl-3-methyl-1h-pyrazole-4-sulfonyl chloride, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-ethyl-3-methylpyrazole-4-sulfonyl chloride (CAS 1005627-55-3) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 1-ethyl-3-methylpyrazole-4-sulfonyl chloride. InChIKey: CIMPNTHRHLIUSL-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 1-ethyl-3-methylpyrazole-4-sulfonyl chloride |
| InChIKey | CIMPNTHRHLIUSL-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
1-ethyl-3-methyl-1H-pyrazole-4-sulfonyl chloride, 1-ethyl-3-methylpyrazole-4-sulfonyl chloride, 1-ethyl-3-methyl-pyrazole-4-sulfonyl chloride, chloro(1-ethyl-3-methylpyrazol-4-yl)sulfone, 1imidazole-1-sulfonyl chloride, CIMPNTHRHLIUSL-UHFFFAOYSA-N, 1-ethyl-3-methyl-1H-pyrazole-4-sulfonylchloride