CAS 100599-06-2 is the registry number for 5-Chloro-2-oxindole-1-carboxamide. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
5-chloro-2-oxo-3H-indole-1-carboxamide (CAS 100599-06-2) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 5-chloro-2-oxo-3H-indole-1-carboxamide. InChIKey: WGRHBRAKCHCGER-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 5-chloro-2-oxo-3H-indole-1-carboxamide |
| InChIKey | WGRHBRAKCHCGER-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Cl)N(C1=O)C(=O)N |
Computed by PubChem (NCBI)