CAS 1006044-27-4 appears in our catalog under these names: 1-tert-Butyl 4-Methyl 4-(Hydroxymethyl)piperidine-1,4-dicarboxylate, 1-tert-Butyl 4-methyl 4-(hydroxymethyl)piperidine-1,4-dicarboxylate, 95%, 1-TERT-BUTYL 4-METHYL 4-(HYDROXYMETHYL)PIPERIDINE-1,4-DICARBOXYLATE, 97%, 1-tert-butyl 4-methyl 4-(hydroxymethyl)piperidine-1,4-dicarboxylate, >95%, >95%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 1g, 250mg, 100mg.
1-O-tert-butyl 4-O-methyl 4-(hydroxymethyl)piperidine-1,4-dicarboxylate (CAS 1006044-27-4) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-(hydroxymethyl)piperidine-1,4-dicarboxylate. InChIKey: UQZQXEFGHRYLNJ-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 4-(hydroxymethyl)piperidine-1,4-dicarboxylate |
| InChIKey | UQZQXEFGHRYLNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CO)C(=O)OC |
Computed by PubChem (NCBI)