Products 100615-58-5
CAS 100615-58-5 is the registry number for 5-(2-Methylpropyl)-5-phenylimidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(2-methylpropyl)-5-phenylimidazolidine-2,4-dione (CAS 100615-58-5) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: 5-(2-methylpropyl)-5-phenylimidazolidine-2,4-dione. InChIKey: SYVOCCKCQWJPAH-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 5-(2-methylpropyl)-5-phenylimidazolidine-2,4-dione |
| InChIKey | SYVOCCKCQWJPAH-UHFFFAOYSA-N |
| SMILES | CC(C)CC1(C(=O)NC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)