Products 1006352-76-6

CAS 1006352-76-6 is the registry number for 3-{((1,3-Dimethyl-1H-pyrazol-4-yl)methyl)sulfanyl}propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[(1,3-dimethylpyrazol-4-yl)methylsulfanyl]propanoic acid (CAS 1006352-76-6) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: 3-[(1,3-dimethylpyrazol-4-yl)methylsulfanyl]propanoic acid. InChIKey: QFRFYAIOKZBWIF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14N2O2S
Molecular weight214.29 g/mol
IUPAC name3-[(1,3-dimethylpyrazol-4-yl)methylsulfanyl]propanoic acid
InChIKeyQFRFYAIOKZBWIF-UHFFFAOYSA-N
SMILESCC1=NN(C=C1CSCCC(=O)O)C

Computed by PubChem (NCBI)