Products 1006433-86-8
CAS 1006433-86-8 is the registry number for 4-{(4-Amino-3-(trifluoromethyl)-1H-pyrazol-1-yl)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[[4-amino-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid (CAS 1006433-86-8) is a chemical compound with the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. IUPAC name: 4-[[4-amino-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid. InChIKey: CNLRVYWKGPRVJM-UHFFFAOYSA-N.
| Molecular formula | C12H10F3N3O2 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | 4-[[4-amino-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid |
| InChIKey | CNLRVYWKGPRVJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C(=N2)C(F)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)