Products 2579028-37-6
CAS 2579028-37-6 is the registry number for N-(3-Methyl-4-pyrazolyl)-4-(trifluoromethoxy)benzamide, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.
N-(5-methyl-1H-pyrazol-4-yl)-4-(trifluoromethoxy)benzamide (CAS 2579028-37-6) is a chemical compound with the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. IUPAC name: N-(5-methyl-1H-pyrazol-4-yl)-4-(trifluoromethoxy)benzamide. InChIKey: MGFGTZFONKPKRT-UHFFFAOYSA-N.
| Molecular formula | C12H10F3N3O2 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | N-(5-methyl-1H-pyrazol-4-yl)-4-(trifluoromethoxy)benzamide |
| InChIKey | MGFGTZFONKPKRT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1)NC(=O)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)