CAS 1416340-56-1 is the registry number for Ethyl 5-(4-(trifluoromethyl)phenyl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-carboxylate (CAS 1416340-56-1) is a chemical compound with the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. IUPAC name: ethyl 3-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-carboxylate. InChIKey: DIYLAJTVNHCLJF-UHFFFAOYSA-N.
| Molecular formula | C12H10F3N3O2 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | ethyl 3-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-carboxylate |
| InChIKey | DIYLAJTVNHCLJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NN1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)