CAS 1111881-70-9 appears in our catalog under these names: 5-Methyl-1-{(4-(trifluoromethyl)phenyl)methyl}-1H-1,2,3-triazole-4-carboxylic acid, 95%, 5-Methyl-1-{(4-(trifluoromethyl)phenyl)methyl}-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]triazole-4-carboxylic acid (CAS 1111881-70-9) is a chemical compound with the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. IUPAC name: 5-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]triazole-4-carboxylic acid. InChIKey: YEJLVTLDKVKEEO-UHFFFAOYSA-N.
| Molecular formula | C12H10F3N3O2 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | 5-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]triazole-4-carboxylic acid |
| InChIKey | YEJLVTLDKVKEEO-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1CC2=CC=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)