Products 2357107-95-8
CAS 2357107-95-8 is the registry number for Methyl 4-(4-amino-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]benzoate (CAS 2357107-95-8) is a chemical compound with the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. IUPAC name: methyl 4-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]benzoate. InChIKey: XKRLFSUBQWLREM-UHFFFAOYSA-N.
| Molecular formula | C12H10F3N3O2 |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | methyl 4-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]benzoate |
| InChIKey | XKRLFSUBQWLREM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N2C=C(C(=N2)C(F)(F)F)N |
Computed by PubChem (NCBI)