Products 1006441-74-2
CAS 1006441-74-2 is the registry number for 3-{5-chloro-3-methyl-1-((4-methylphenyl)methyl)-1H-pyrazol-4-yl}prop-2-enoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoic acid (CAS 1006441-74-2) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: (E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoic acid. InChIKey: XBJMZXICJKUGKH-BQYQJAHWSA-N.
| Molecular formula | C15H15ClN2O2 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | (E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoic acid |
| InChIKey | XBJMZXICJKUGKH-BQYQJAHWSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=C(C(=N2)C)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)