CAS 1006473-01-3 is the registry number for 3-(5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)propanoyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanoyl chloride (CAS 1006473-01-3) is a chemical compound with the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. IUPAC name: 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanoyl chloride. InChIKey: HRBUCGGOKQYPCJ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N2O |
|---|---|
| Molecular weight | 266.65 g/mol |
| IUPAC name | 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanoyl chloride |
| InChIKey | HRBUCGGOKQYPCJ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NN2CCC(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)