CAS 1208674-60-5 is the registry number for 2-((2-Chlorophenyl)amino)-N-(2,2,2-trifluoroethyl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloroanilino)-N-(2,2,2-trifluoroethyl)acetamide (CAS 1208674-60-5) is a chemical compound with the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. IUPAC name: 2-(2-chloroanilino)-N-(2,2,2-trifluoroethyl)acetamide. InChIKey: LZTMGRLOOZVSCZ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N2O |
|---|---|
| Molecular weight | 266.65 g/mol |
| IUPAC name | 2-(2-chloroanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| InChIKey | LZTMGRLOOZVSCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCC(=O)NCC(F)(F)F)Cl |
Computed by PubChem (NCBI)