Products 2711-21-9
CAS 2711-21-9 is the registry number for 1-(4-chloro-3-(trifluoromethyl)phenyl)-3-ethylurea. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-ethylurea (CAS 2711-21-9) is a chemical compound with the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-ethylurea. InChIKey: KNSAKEPDCOPDNM-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N2O |
|---|---|
| Molecular weight | 266.65 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-ethylurea |
| InChIKey | KNSAKEPDCOPDNM-UHFFFAOYSA-N |
| SMILES | CCNC(=O)NC1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)