Products 2711-18-4
CAS 2711-18-4 is the registry number for 3-(4-chloro-3-(trifluoromethyl)phenyl)-1,1-dimethylurea. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-chloro-3-(trifluoromethyl)phenyl]-1,1-dimethylurea (CAS 2711-18-4) is a chemical compound with the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. IUPAC name: 3-[4-chloro-3-(trifluoromethyl)phenyl]-1,1-dimethylurea. InChIKey: BCZPKLASFYQQRE-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N2O |
|---|---|
| Molecular weight | 266.65 g/mol |
| IUPAC name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1,1-dimethylurea |
| InChIKey | BCZPKLASFYQQRE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)