CAS 1909328-14-8 is the registry number for N-(2,3-Dihydro-1H-isoindol-5-yl)-2,2,2-trifluoroacetamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(2,3-dihydro-1H-isoindol-5-yl)-2,2,2-trifluoroacetamide;hydrochloride (CAS 1909328-14-8) is a chemical compound with the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. IUPAC name: N-(2,3-dihydro-1H-isoindol-5-yl)-2,2,2-trifluoroacetamide;hydrochloride. InChIKey: TZAUCLMNZOKHKN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N2O |
|---|---|
| Molecular weight | 266.65 g/mol |
| IUPAC name | N-(2,3-dihydro-1H-isoindol-5-yl)-2,2,2-trifluoroacetamide;hydrochloride |
| InChIKey | TZAUCLMNZOKHKN-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)NC(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)