Products 1006891-20-8

CAS 1006891-20-8 is the registry number for tert-Butyl (cis-4-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3S,4S)-4-(hydroxymethyl)oxan-3-yl]carbamate (CAS 1006891-20-8) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-(hydroxymethyl)oxan-3-yl]carbamate. InChIKey: FTBOFNJQEUGOPO-RKDXNWHRSA-N.

Identity
Molecular formulaC11H21NO4
Molecular weight231.29 g/mol
IUPAC nametert-butyl N-[(3S,4S)-4-(hydroxymethyl)oxan-3-yl]carbamate
InChIKeyFTBOFNJQEUGOPO-RKDXNWHRSA-N
SMILESCC(C)(C)OC(=O)N[C@@H]1COCC[C@@H]1CO

Computed by PubChem (NCBI)