CAS 1006950-61-3 is the registry number for [3-(5-Methyl-3-nitro-1h-pyrazol-1-yl)propyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(5-methyl-3-nitropyrazol-1-yl)propan-1-amine (CAS 1006950-61-3) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: 3-(5-methyl-3-nitropyrazol-1-yl)propan-1-amine. InChIKey: KXNWEYIERAXIBS-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 3-(5-methyl-3-nitropyrazol-1-yl)propan-1-amine |
| InChIKey | KXNWEYIERAXIBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CCCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)