CAS 14612-28-3 appears in our catalog under these names: 7-Nitro-1,3,5-triazatricyclo[3.3.1.1(3,7)]decane, 95%, 7-NItro-1,3,5-triazatricyclo(3.3.1.1(3,7))decane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
7-nitro-1,3,5-triazatricyclo[3.3.1.13,7]decane (CAS 14612-28-3) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: 7-nitro-1,3,5-triazatricyclo[3.3.1.13,7]decane. InChIKey: LPPLVTOEOMJNPS-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 7-nitro-1,3,5-triazatricyclo[3.3.1.13,7]decane |
| InChIKey | LPPLVTOEOMJNPS-UHFFFAOYSA-N |
| SMILES | C1C2(CN3CN1CN(C2)C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)