CAS 14094-38-3 appears in our catalog under these names: 6-Amino-5-(dimethylamino)-1-methylpyrimidine-2,4(1h,3h)-dione, 95%, 6-Amino-5-(dimethylamino)-1-methylpyrimidine-2,4(1H,3H)-dione, 95+%, 6-Amino-5-(dimethylamino)-1-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
6-amino-5-(dimethylamino)-1-methylpyrimidine-2,4-dione (CAS 14094-38-3) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: 6-amino-5-(dimethylamino)-1-methylpyrimidine-2,4-dione. InChIKey: WYLHRNPUYIFLAD-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 6-amino-5-(dimethylamino)-1-methylpyrimidine-2,4-dione |
| InChIKey | WYLHRNPUYIFLAD-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)NC1=O)N(C)C)N |
Computed by PubChem (NCBI)