CAS 2007909-06-8 is the registry number for N,N-Dimethyl-2-(3-nitro-1h-pyrazol-1-yl)ethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N,N-dimethyl-2-(3-nitropyrazol-1-yl)ethanamine (CAS 2007909-06-8) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: N,N-dimethyl-2-(3-nitropyrazol-1-yl)ethanamine. InChIKey: ZHBFIVPMARWLTP-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | N,N-dimethyl-2-(3-nitropyrazol-1-yl)ethanamine |
| InChIKey | ZHBFIVPMARWLTP-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C=CC(=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)