CAS 4318-53-0 appears in our catalog under these names: 1,3-Dimethyl-6-(1-methylhydrazino)-2,4(1h,3h)-pyrimidinedione, 95%, 1,3-Dimethyl-6-(1-methylhydrazin-1-yl)-1,2,3,4-tetrahydropyrimidine-2,4-dione, 90%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
6-[amino(methyl)amino]-1,3-dimethylpyrimidine-2,4-dione (CAS 4318-53-0) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: 6-[amino(methyl)amino]-1,3-dimethylpyrimidine-2,4-dione. InChIKey: AAGNSLIYEXHQKO-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 6-[amino(methyl)amino]-1,3-dimethylpyrimidine-2,4-dione |
| InChIKey | AAGNSLIYEXHQKO-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=O)N(C1=O)C)N(C)N |
Computed by PubChem (NCBI)